V mühazirə üzvi turşular. Sadə və mürəkkəb efirlər



Yüklə 85,77 Kb.
tarix02.03.2018
ölçüsü85,77 Kb.
növüMühazirə



v mühazirə


üzvi turşular. Sadə və mürəkkəb efirlər

Üzvi turşular molekulunda karboksil qrupunun–COOH olması ilə səciyyələnir.Karboksil qrupunun sayına görə üzvi turşular bir-, iki- və çoxəsaslı olurlar.Əsas nümayəndələri aşağıdakılardır:

HCOOH Qarışqa turşusu, metan turşusu

CH3COOH Sirkə turşusu, etan turşusu

CH3Ch2COOH Propion turşusu. Propan turşusu

CH3CH2CH2COOH Yağ turşusu, butan turşusu

CH3CH2CH2CH2COOH Valerian turşusu, pentan turşusu

(Səməri üsulla) CH3-CH2-CH-COOH α -Metilyağ turşusu



|

group 517 CH3

,-Dimetilvalerian turşusu


(Beynəlxal nomeklaturaya görə)
CH3–CH2CH2–COOH Bgroup 527utan turşusu

2,5-


dimetil-3,4-dietilheksan turşusu
C11H23COOH Laurin turşusu

C13H27COOH Miristin turşusuC15H31COOH C17H35COOH Stearin turşusu




group 542

-Fenilpropion turşusu




group 551

- Fenilpropion turşusu



group 560

о-Toluil turşusu



group 571
м-Toluil turşusu
group 583

p-Toluil turşusu


Alınması. Kabohidrogenlərin oksidləşməsindən



group 594group 601group 622

2. Spirtlərin oksidləşməsindən



group 644group 651
3. Aldehidlırin oksidləşməsindən

group 658group 672
4. Ketonların oksidləşməsində

group 702group 709group 731
Nitrillərin hidrolizindən
group 738
6

group 761

Təbiətdə rast gəlinən turşularda karbon atomlarının sayı 4-dən 22-yə qədər olur. Insan orqanizmində alınmaları:

1. Lipidlərin hidrolizi

:

group 820



group 787group 798group 867

Xassələri. Tərkibində karbon atomlarının sayı 8-ə qədər olan alifatik turşular maye, 8-dən çox olanlar isə bərk haldadır.

Başqa qruplardan fərqli olaraq karboksil qrupu daha mürəkkəb quruluşludur.

group 877
Busxemdə elektron sıxlığı karbonol qrupunun oksigeninə tərəf meyl edir və O-H rabitəsi qütbləşir və OH turşuluq mərkəzi əmələ gəlir.
group 1072 -

autoshape 1574autoshape 1575

group 890group 901

group 909

Əsas reaksiyaları aşağıdakılardır.


Qələvilərlə reaksiyası:

CH3COOH + NaOH  CH3COONa + H2O



group 914
PCL5-lə reaksiyası:
CH3COOH + PCl5  CH3COCl + POCl3 + HCl

group 931
Spirtlərlə reaksiyası:



group 949
Ammonyakla reaksiyası:



group 970group 991group 1002group 1119

Doymuş turşularda karboksil qrupunun elektronakseptor effekti α-karbon atomu yanında hidrogen atomunun daha asan əvəz olmasına səbəb olur.Fluorla reaksiya daha asan gedir.

Monofluorsirkə turşusu (CH2F-COOH) zəhərləyici maddədir. O bəzi tropik bitkilərin şirəsində rast gəlir. Onun bəzi duzları gəmiricilərə qarşı mübarizədə istifadə edilir.

group 1013

Karbon turşularının asetilenlə qarşılıqlı təsirindən mürəkkəb vinil efirləri əmələ gəlir.

CH3COOH + C2H2 → CH3COOCH=CH2
group 1035group 1055
Tibbi-bioloji əhəmiyyəti.Qaraciyərdə benzoy turşusu qlisinlə(aminsirkə turşusu) reksiyaya girərək aminsirkə turşusunun N-benzoil törəməsini əmələ gətirir. Bu birləşmə hippur yurşusu adlanır. O qaraciyərdən sidik vasitəsi ilə xaric olur.
C6H5COOH + NH2CH2COOH→CH3CONHCH2COOH + H2O
Hippur turşusüu ot yeyən heyvanların sidiyində daha çox olur. Çünki, benzoy turşusu bitki mənşəli qidaların tərkibində dah çox olur.

Birəsaslə doymamiş turşular

CH2 = CH – COOH Акril turşusuрил туршусу

CH3–CH=CH–COOH Кroton turşusuротон туршусу

CH2=CH–CH2–COOH Vinilsirkə turşusu

group 1129

Метакрил туршусу


group 1133

Darçın turşusu

; CH3(CH2)3(CH2CH=CH)2(CH2)7COOH – Linol turşusu

C17H29COOH; CH3(CH2CH=CH)3(CH2)7COOH – Linolen turşusu

C19H31COOH; CH3(CH2)2(CH2CH=CH)4(CH2)4COOH– Araxidin turşusu

Alınması.



group 1155group 1168
group 1196
group 1203

group 1214
CH  CH + CO + H2O  CH2 = CH – COOH

group 1217group 1224
Xassələri Kroton turşusunun üç izomeri vardır:
CH2=CH–CH2–COOH

CH3–CH=CH–COOH

Doymamiş birəsaslı turşular həm doymamış karbohidrogenlərə, hım də turşulara xas olan reaksiyalara daxil olur
group 1141

İkiəsaslə doymuş turşular.



group 1234

Oksalat turşusu



group 1238

Маlon turşusu


group 1244
Kəhraba turşusu

Canlı orqanizmlərdə müxtəlif üzvi birləşmələr, o cümlədən spirtlər müvafiq ferment iştirakı ilə turşuya qədər oksidləşirlər. Bəzən bu reaksiya xoşagəlməz nəticəyə səbəb olur. Məsələn, oksalat turşusu orqanizm üçün qüvvətli zəhərdir.Əgər orqanizmə ikiatomlu spirt olan etilenqlikol daxil olarsa, o oksidləşərək, oksalat turşusu əmələ gətirir və orqanizmi zəhərləyir..


group 1248group 1259group 1274group 1285

Qızdırdıqda anhidridlər əmələ gəlir:


autoshape 1576rectangle 1577autoshape 1578 group 1299

Dekarboksilləşmə karboksil qrupu ilə radikalın arasındakı radikalın möhkəmliyindən asılı olur. Elektronakseptor əvəzedicilər bu rabitəni zəiflədir. Məsələn, oksalat turşusunu azca qızdırdıqda dekarboksilləşir.

Malon turşusu oksalat turşusuna nisbətən daha yüksək temperaturda dekarboksilləşir, kəhrəba turşusunu isə qızdırmaqla dekarboksilləşdirmək mümkün olmur. Malon turşusund və onun efirlərində α-karbon atomunda elektronakseptor effekt birəsaslı turşulara nisbətən daha güclü olur. İki karboksil qrupunun effektlərinin cəmi o qədər yüksək olur ki, α-hidrogen atomu turşu hidrogeni kimi fəal metallarla əvəz olunur. Bundan istifadə edərək, malon turşusunun və onun efirlərinin α-əvəzolunmuş homoloqlarını alırlar.
COOC2H5 COOC2H5 COOC2H5

│ │ │


CH2 + Na → HCNa + C2H5CI → CH-C2H5

│ │ │


COOC2H5 COOC2H5 COOC2H5
Oksidləşmə reaksiyası:

group 1347group 1364

Doymamış turşulara xas olan reaksiyaları:

HOOC–CH=CH–COOH + H2  HOOC–CH2–CH2–COOH

HOOC–CH=CH–COOH + HCl  HOOC–CH2–CHCl–COOH



group 1328HOOC–CH=CH–COOH + HOH  HOOC–CH –CH2–COOH
group 1331group 1339

Fumar turşusundan fərqli olaraq malein turşusu anhidrid əmələ gətirir:



group 1386
Divinil malein anhidridi ilə reaksiyaya daxil olduqda tetrahidroftal anhidridi alınır:
group 1403

Sadə efirlər.Spirtlərin və fenolların hidroksil qrupunun hidrogenini karbohidrogen radikalı ilə əvəz etdikdə sadə efirlər alınır.(R-O-R). Əsas nümayəndələri:

CH3–O–CH3 Dimetil efiri

CH3–O–C2H5 Metiletil efiri

C2H5–O–C2H5 Dietil efiri

C6H5–O–C6H5 Difenil efiri

C6H5–O–CH3 Fenilmetil efiri

CH3–O–CH2–CH2–CH3 Metilpropil efiri


Sadə efirlərdə oksigen atomu tsiklə də daxil ola bilər. Məsələn, etilenoksid, tetrahidrofuran, dioksan, furan və s. belə

efirlərdəndir.




Alınması. 1.


group 1449group 1461
2.
3. C2H5ONa + CH3–CH2–J  C2H5–O–C2H5 + NaJ

group 1485

4. 2C2H5Cl+ CaO  C2H5–O–C2H5 + CaCl2.


5. Spirtlərin asetilenə elektrofil birləşmə reaksiyasından alınır.
C2H2 + C2H5OH → CH2=CH-O-C2H5
Xassələri. Sadə efirlər oksigen atomunun bölünməmi. Elektron cütü hesabına əsasi xassəyə malik olur. малик олур. Alifatik efirlər aromatik efirlərə nisbətən daha qüvvətli əsaslardır.

CH3OCH3 > CH3OC6H5 > C6H5O C6H5.


group 1517
C6H5 – O– CH3 + HJ  C6H5OH + CH3J

group 1523group 1531
2.C2H5 – O– C2H5 + HOSO3H  C2H5OH + C2H5OSO3H.
group 1546group 1552
Sadə efir qrupları bir çox alkaloidlərdə və dərman preparatlarında olur. Məsələn. Papaverin molekulunun tərkibində dörd, rezerpin molekulunda isə (Alkaloidlər bəhsinə bax). beş sadə efir qrupu var.

Papaverin təbabətdə qıcolmaya qarşı, rezerpin isə sakitləşdirici və qan təzyiqinin azaldan dərman kimi istifadə edilir.


Vinilbutil efirinin (CH2=CH-O-C4H9) polimeri Şostakovski balzamı adlanır və yaraların sağalmasında istifadə edilir.

Mürəkkəb efirlər canlı təbiətdə geniş yatılıblar. Onlardan bir çoxu bitki toxumlarının, güllərin, efir yağlarının tərkibinə daxil olur.

Lipidlər də üçatomlu spirt olan qliserinin ali yağ turşuları ilə mürəkkəb efirləridir.

Arı şanının tərkibinə digər birləşmələrlə yanaşı palmitin turşusunun (C15H31COOH) mirisil spirti ilə (C31H63-OH) əmələ gətirdiyi mürəkkəb efir də (C15H31COO-C31H63 ) daxil olur.

İzovalerian turşusunun mentil efiri validol adlanır və təbabətdə damar genişləndirici dərman preparatı kimi istifadə olunur.

CH3

‌‌│

CH2-CH-CH2

│ │

CH2-CH-CH-CO-CH2-CH(CH)2 Validol



CH(CH3)2

Dərman maddələrindən olan aspirin, salol və novokain molekullarında da mürəkkəb efir qruplaşması vardır (oksiturşular bəhsinə bax).

Aspirin soyuqdəymə, titrətmə, baş ağrısı, və nevralgiya zamanı istifadə edilir.

Tiospirtlər.Hidrogensulfid molekulundakı hidrogenlərdən birini üzvi radikalla əvəz etdikdə həm də tiollar və yaxud merkaptanlar adlanan tiospirtlər alınır. Aşağıda onlardan bəzilərinin kimyəvi düsturları və adları verilmişdir:

CH3-SH C2H5-SH C6H5-SH

Metilmerkaptan; Etilmerkaptan; Fenilmerkaptan;

Metiltiol etiltiol feniltiol


(CH3)2CH-CH2-SH (CH3)2CH-SH

Birli-izobutilmerkaptan; İzopropilmerkaptan;


Tiollardakı HS qrupu zülalların və bəzi digər biomolekulların tərkibinə daxil olaraq, canlı orqanizmlərdə vacib biokimyəvi rol oynayır.

Tiollar zəif turşu xassəsinə malikdirlər. Ancaq, onların turşuluğu müvafiq spirtlərin turşuluğundan yüksək olur.

Alınması. Tiolların alınması üçün digər üsullarla yanaşı aşağıdakı üsullardan da istifadə edilir.

1. Alkilhalogenidlərə natrium və ya kaliumhidrosulfidlə təsir etməklə.

C3H7J + KSH → C3H7SH + KJ

2. Alüminium oksid iştirakı ilə spirtlərə müəyyən temperaturda hidrogensulfidlə təsir etməklə

C2H5OH + H2S → C2H5SH + H2O

3. Aril- və alkilsulfohalogenidləri reduksiya etməklə.

R-SO2-CI + H → (Zn+H2SO4) → R-SH

4. Aril- və alkilsulfoturşuların reduksiyasından müxtəlif tiollar alınır.

R-SO2OH + H → RSH + HOH

5. Metalüzvi birləşmələrə əvvəlcə kükürdlə təsir edib, sonra hidrolizə uğratdıqda tiollar alınır.

R-MqCI + S → R-S-Mq-CI HOH RSH + MqOHCI

6. α –Oksidlərə hidrogensulfidlə təsir etdikdə heterofunksional birləşmələrdən olan merkaptospirtlər alınır.



+ HSH → HOCH2-CH2-SH

7. Spirtlərə P2O5-lə təsir etdikdə merkaptanlar alınır.

5ROH + P2O5 5ROH + P2O5
Fiziki xassələri. Metilmerkaptan adi şəraitdə qazdır. Qalan tiollar maye və ya bərk maddələrdir. Suda pis, üzvi həlledicilərdə yaxşı həll olurlarSpirtlərdən fərqli olaraq tiospirtlərin çox kəskin pis iyi var.

Kimyəvi xassələri.

1. Tiolların tərkibində elektrofilliyi yüksək olan kükürd atomu ilə birləşmiş fəallığı yüksək olan hidrogen atomu var. Ona görə də tiollar zəif turşulardır. Onlar qələvilərlə reaksiyaya girərək, merkaptidlər və ya tiolyatlar əmələ gətirirlər.

C2H5-SH + KOH → C2H5-SK +HOH

Eyni bir kationun əmələ gətirdiyi merkaptidlər H2S-in əmələ gətirdiyi sulfidlərə nisbətən daha çətin həll olurlar. Onların trivial adlarının merkaptan olması bu xassə ilə əlaqədardır. Latınca merkaptan sözü “civəni çökdürən birləşmə” deməkdir.
2. Merkaptanlarda oksidləşmə kükürd atomunda gedir. Zəif oksidləşdiricilərlə disulfidlər, qüvvətli oksidləşdiricilərlə isə sulfoturşular əmələ gəlir. Disulfidlərin əmələ gəlməsi reaksiyası dönər reaksiyadır.

2CH3-SH + O → CH3-S-S-CH3 + H2O

C2H5-SH + O (KMnO4) → CH3CH2-SO2-OH
3. Katalizator iştirakı ilə tiolları hidrogenlə birlikdə qızdırdıqda karbohidrogenlər və hidrogensulfid əmələ gəlir.

R-SH + H-H → R-H + H2S

4. Tiollar alkenlərlə birləşmə reaksiyasına daxil olaraq, sulfidlər əmələ gətirirlər.

CH3CH=CH2 + HS-CH3 → CH3CH2CH2-S-CH3


5. Qüvvətli mineral turşular iştirakı ilə üzvi turşularla mürəkkəb tioefirlər əmələ gətirirlər.

CH3-COOH + HSCH3 → CH3COOSCH3

Canlı orqanizmlərdə çox böyük rol oynayan A kofermentinin də (HS_KoA) tərkibində HS qrupu var. Bu reaksiya vasitəsilə asetil qrupu A kofermentinə ötürülür və nəticədə asetilkoferment A alınır.

KoA-SH + CH3COOH KoA-S-COCH3 + H2O

Asetilkoferment A

Alınmış asetilkofermentin asetil qrupu təkibində hidroksil qrupu olan biosubstrata, məsələn xolinə ötürülür və nəticədə asetilxolin alınır. Xolin isə mürəkkəb lipidlərin tərkibinə daxil olur və onların biosintezində istifadə olunur (lipidlər bəhsinə bax).

KoA-COCH3 + HOCH2CH2N+(CH3)3OH →

→ CH3COOCH2CH2N(CH3)3OH


Canlı orqanizmlərdə biokimyəvi proseslərin gedişinə bioloji katalizatorlar olan fermentlər təsir eləyir. Fermentativ təsir zamanı əsas rolu ferment molekuluna daxil olan kofermentlər oynayır. Biokimyəvi proseslər zamanı onlar müəyyən dəyişikliyə uğrayır, prosesin sonunda isə, bərpa olunur.

Tərkibində SH qrupu olan SHKoA-nın köməyi ilə ali yağ turşuları, hormonlar və bəzi mikroorqanizmlərdə antibiotiklər biosintez olunur.

Tiollar asan oksidləşdiklərinə, yəni qüvvətli reduksiyaedicilər olduqları üçün in vivo oksidləşmə zamanı oksidləşmə ilk növbədə biomolekulların tiol qruplarında gedir. Deməli, bu yolla toxumalar oksidləşmədən qorunurlar, yəni, müdafiyə olunurlar.

Zülalların üçüncü quruluşunun yaranmasında digər rabitələrlə yanaşı disulfid rabitəsinin də əmələ gəlməsi mühüm rol oynayır.(Peptidlər və zülallar bəhsinə bax). Reduksiyaedicilərin təsiri ilə disulfid rabitəsinin tiol rabitəsinə çevrilməsi nəticəsində zülal molekulu denaturatlaşa və bioloji xassəsini itirə bilər.

Bəzi hallarda zəif oksidləşdiricilərin təsiri ilə disulfid rabitəsi yenidən yarana, quruluş yenidən bərpa oluna (renaturatlaşa) və xassələrini bərpa eləyə bilər.

Bu proseslərin biri-birinə dönər olaraq keçidi həmin biomühiddə oksidləşdiricilərin və reduksiyaedicilərin miqdarından asılı olur. Prosesin dönər olması üçün bu nisbər müəyyən çərçivə daxilində olmalıdır.

Tük və dırnaq zülallarında disulfid körpücükləri daha çoxdur. Bu çoxluq onlara quruluş codluğu xassəsini verir.

Bəzi ağır metallar fermentlərin tiol qrupları ilə reaksiyaya girir. Bu zaman ferment öz fermentativ təsirini itirir. Məsələn, 6,8-dimerkaptooktan turşusu oksidaza fermentlərinin kofermentidir(kofaktorudur). Onun molekuluna iki tiol qrupu daxil olur. Zəhərləyici maddə kimi hərbidə istifadə olunan lyuizitin tərkibində arsen metalı var. Lyuizitin tərkibindəki arsen kofermentdəki tiol qruplarının kükürd atomları ilə birləşir. Fermentativ təsir itir, orqanizmə mənfi təsir olur.


CI-CH=CH-AsCI2 HS-CH2-CH2-CH(SH)-(CH2)4-COOH

β-Xlorvinildixlorarsen; 6,8-Dimerkaptooktan turşusu

lyuizit

‌‌

CI-CH=CH-AsCI2 + HS-CH2-CH2-CH(SH)-(CH2)4-COOH →


→ CH2 CH2CH-(CH2)4-COOH + HCI

І І


S - As- S

І

CH=CH-CI



Ağır metal ionlarının orqanizmə yuxarıda göstərilən zəhərləyici təsirinin qarşısını almaq üçün Na2S-in sulu məhlulundan istifadə edilir. Çünki, ağır metal natriumsulfidlə reaksiyaya girərək, həll olmayan sulfid duzu əmələ gətirir və orqanizmdən xaric olur.

Me+ + Na2S → MeS + Na+



Lyuizit kimi zəhərli maddələrə qarşı istifadə edilə biləcək daha faydalı çarə(antidot), yəni əkszəhər tərkibində birdən çox tiol qrupu olan merkaptanlardır. Çünki, onlar toksik kationları daha möhkəm birləşdirir və onların zəhərləyici təsirinin qarşısını alır.





Dostları ilə paylaş:


Verilənlər bazası müəlliflik hüququ ilə müdafiə olunur ©genderi.org 2019
rəhbərliyinə müraciət

    Ana səhifə